C12H13NO2 — CID 164675976
5-methylidene-3-(1-phenylethyl)-1,3-oxazolidin-2-one (PubChem CID 164675976) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-methylidene-3-(1-phenylethyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-methylidene-3-(1-phenylethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 164675976 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-methylidene-3-(1-phenylethyl)-1,3-oxazolidin-2-one |
| SMILES | C=C1CN(C(C)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C12H13NO2/c1-9-8-13(12(14)15-9)10(2)11-6-4-3-5-7-11/h3-7,10H,1,8H2,2H3 |
| InChIKey | XLLCUKMGZXJGHJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |