C17H29N3O3 — CID 164676000
4-(2-piperidin-1-ylethoxy)-3,6-di(propan-2-yloxy)pyridazine (PubChem CID 164676000) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(2-piperidin-1-ylethoxy)-3,6-di(propan-2-yloxy)pyridazine.
| Compound Name | 4-(2-piperidin-1-ylethoxy)-3,6-di(propan-2-yloxy)pyridazine |
|---|---|
| PubChem CID | 164676000 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 4-(2-piperidin-1-ylethoxy)-3,6-di(propan-2-yloxy)pyridazine |
| SMILES | CC(C)Oc1cc(OCCN2CCCCC2)c(OC(C)C)nn1 |
| InChI | InChI=1S/C17H29N3O3/c1-13(2)22-16-12-15(17(19-18-16)23-14(3)4)21-11-10-20-8-6-5-7-9-20/h12-14H,5-11H2,1-4H3 |
| InChIKey | JXWLLPXMHVSREN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |