C24H26O3 — CID 164676141
methyl (2R)-2-[(1S)-1-hydroxy-1-naphthalen-1-ylethyl]-5-phenylpentanoate (PubChem CID 164676141) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl (2R)-2-[(1S)-1-hydroxy-1-naphthalen-1-ylethyl]-5-phenylpentanoate.
| Compound Name | methyl (2R)-2-[(1S)-1-hydroxy-1-naphthalen-1-ylethyl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 164676141 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | methyl (2R)-2-[(1S)-1-hydroxy-1-naphthalen-1-ylethyl]-5-phenylpentanoate |
| SMILES | COC(=O)[C@H](CCCc1ccccc1)[C@](C)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H26O3/c1-24(26,21-16-9-14-19-13-6-7-15-20(19)21)22(23(25)27-2)17-8-12-18-10-4-3-5-11-18/h3-7,9-11,13-16,22,26H,8,12,17H2,1-2H3/t22-,24+/m0/s1 |
| InChIKey | IUJCLYUQFIIUGZ-LADGPHEKSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |