C24H38O4 — CID 164676248
2-methyl-2-[2-[2-[(4E,8E)-8-methyltetradeca-4,8-dien-12-ynyl]-1,3-dioxolan-2-yl]ethyl]-1,3-dioxolane (PubChem CID 164676248) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-methyl-2-[2-[2-[(4E,8E)-8-methyltetradeca-4,8-dien-12-ynyl]-1,3-dioxolan-2-yl]ethyl]-1,3-dioxolane.
| Compound Name | 2-methyl-2-[2-[2-[(4E,8E)-8-methyltetradeca-4,8-dien-12-ynyl]-1,3-dioxolan-2-yl]ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 164676248 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 2-methyl-2-[2-[2-[(4E,8E)-8-methyltetradeca-4,8-dien-12-ynyl]-1,3-dioxolan-2-yl]ethyl]-1,3-dioxolane |
| SMILES | CC#CCC/C=C(\C)CC/C=C/CCCC1(CCC2(C)OCCO2)OCCO1 |
| InChI | InChI=1S/C24H38O4/c1-4-5-6-10-13-22(2)14-11-8-7-9-12-15-24(27-20-21-28-24)17-16-23(3)25-18-19-26-23/h7-8,13H,6,9-12,14-21H2,1-3H3/b8-7+,22-13+ |
| InChIKey | AOUBGSWZDVQFNB-CASIMXJUSA-N |
| XLogP | 5.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|