C10H16O2 — CID 164676301
(3E,5R)-5-methyl-3-pentylideneoxolan-2-one (PubChem CID 164676301) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3E,5R)-5-methyl-3-pentylideneoxolan-2-one.
| Compound Name | (3E,5R)-5-methyl-3-pentylideneoxolan-2-one |
|---|---|
| PubChem CID | 164676301 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3E,5R)-5-methyl-3-pentylideneoxolan-2-one |
| SMILES | CCCC/C=C1\C[C@@H](C)OC1=O |
| InChI | InChI=1S/C10H16O2/c1-3-4-5-6-9-7-8(2)12-10(9)11/h6,8H,3-5,7H2,1-2H3/b9-6+/t8-/m1/s1 |
| InChIKey | BEUIZLAUWLZVEB-GTUWVTDSSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|