About 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene
1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene (PubChem CID 164676360) has the molecular formula C18H16F2O
and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene.
Molecular Properties
| Compound Name | 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene |
| PubChem CID | 164676360 |
| Molecular Formula | C18H16F2O |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene |
| SMILES | CO/C(=C\C=C\Cc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16F2O/c1-21-18(15-8-12-17(20)13-9-15)5-3-2-4-14-6-10-16(19)11-7-14/h2-3,5-13H,4H2,1H3/b3-2+,18-5- |
| InChIKey | YHUPRMJGMINJKF-YTKWLHLVSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene?
The IUPAC name of 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene (CID 164676360) is 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene.
What is the SMILES notation for 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene?
The canonical SMILES for 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene is CO/C(=C\C=C\Cc1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene?
The InChIKey is YHUPRMJGMINJKF-YTKWLHLVSA-N. The full InChI is InChI=1S/C18H16F2O/c1-21-18(15-8-12-17(20)13-9-15)5-3-2-4-14-6-10-16(19)11-7-14/h2-3,5-13H,4H2,1H3/b3-2+,18-5-.
What are the key properties of 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene?
1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene has a molecular weight of 286.32 g/mol, XLogP of 4.75, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-[(1Z,3E)-5-(4-fluorophenyl)-1-methoxypenta-1,3-dienyl]benzene is sourced from PubChem (CID 164676360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).