C18H16Cl2O — CID 164676364
1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene (PubChem CID 164676364) has the molecular formula C18H16Cl2O and a molecular weight of 319.23 g/mol. Its IUPAC name is 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene.
| Compound Name | 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 164676364 |
| Molecular Formula | C18H16Cl2O |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene |
| SMILES | CO/C(=C\C=C\Cc1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C18H16Cl2O/c1-21-18(15-10-4-6-12-17(15)20)13-7-3-9-14-8-2-5-11-16(14)19/h2-8,10-13H,9H2,1H3/b7-3+,18-13- |
| InChIKey | SHXKYGHDDNIPLX-JMGROZJKSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|