About 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene
1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene (PubChem CID 164676364) has the molecular formula C18H16Cl2O
and a molecular weight of 319.23 g/mol. Its IUPAC name is 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene.
Molecular Properties
| Compound Name | 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene |
| PubChem CID | 164676364 |
| Molecular Formula | C18H16Cl2O |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene |
| SMILES | CO/C(=C\C=C\Cc1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C18H16Cl2O/c1-21-18(15-10-4-6-12-17(15)20)13-7-3-9-14-8-2-5-11-16(14)19/h2-8,10-13H,9H2,1H3/b7-3+,18-13- |
| InChIKey | SHXKYGHDDNIPLX-JMGROZJKSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene?
The IUPAC name of 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene (CID 164676364) is 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene.
What is the SMILES notation for 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene?
The canonical SMILES for 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene is CO/C(=C\C=C\Cc1ccccc1Cl)c1ccccc1Cl.
What is the InChIKey of 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene?
The InChIKey is SHXKYGHDDNIPLX-JMGROZJKSA-N. The full InChI is InChI=1S/C18H16Cl2O/c1-21-18(15-10-4-6-12-17(15)20)13-7-3-9-14-8-2-5-11-16(14)19/h2-8,10-13H,9H2,1H3/b7-3+,18-13-.
What are the key properties of 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene?
1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene has a molecular weight of 319.23 g/mol, XLogP of 5.78, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-[(1Z,3E)-5-(2-chlorophenyl)-1-methoxypenta-1,3-dienyl]benzene is sourced from PubChem (CID 164676364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).