About ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate
ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate (PubChem CID 164676556) has the molecular formula C12H21NO5
and a molecular weight of 259.30 g/mol. Its IUPAC name is ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate |
| PubChem CID | 164676556 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate |
| SMILES | CCOC(=O)C/C(=N\OC)C(C)(C)COC(C)=O |
| InChI | InChI=1S/C12H21NO5/c1-6-17-11(15)7-10(13-16-5)12(3,4)8-18-9(2)14/h6-8H2,1-5H3/b13-10+ |
| InChIKey | UMXSACPXSHKLQH-JLHYYAGUSA-N |
| XLogP | 1.53 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate?
The IUPAC name of ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate (CID 164676556) is ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate.
What is the SMILES notation for ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate?
The canonical SMILES for ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate is CCOC(=O)C/C(=N\OC)C(C)(C)COC(C)=O.
What is the InChIKey of ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate?
The InChIKey is UMXSACPXSHKLQH-JLHYYAGUSA-N. The full InChI is InChI=1S/C12H21NO5/c1-6-17-11(15)7-10(13-16-5)12(3,4)8-18-9(2)14/h6-8H2,1-5H3/b13-10+.
What are the key properties of ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate?
ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate has a molecular weight of 259.30 g/mol, XLogP of 1.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3E)-5-acetyloxy-3-methoxyimino-4,4-dimethylpentanoate is sourced from PubChem (CID 164676556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).