ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate

C19H15F2NO2 — CID 164676593

IUPACethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate
SMILESCCOC(=O)C(F)(F)c1cnc2ccccc2c1-c1ccccc1
InChIInChI=1S/C19H15F2NO2/c1-2-24-18(23)19(20,21)15-12-22-16-11-7-6-10-14(16)17(15)13-8-4-3-5-9-13/h3-12H,2H2,1H3
InChIKeyZFPMWHKCWIGAMT-UHFFFAOYSA-N
MW327.33 g/mol
LogP4.56
Rot. Bonds4

About ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate

ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate (PubChem CID 164676593) has the molecular formula C19H15F2NO2 and a molecular weight of 327.33 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate.

Molecular Properties

Compound Nameethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate
PubChem CID164676593
Molecular FormulaC19H15F2NO2
Molecular Weight327.33 g/mol
Exact Mass327.11
IUPAC Nameethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate
SMILESCCOC(=O)C(F)(F)c1cnc2ccccc2c1-c1ccccc1
InChIInChI=1S/C19H15F2NO2/c1-2-24-18(23)19(20,21)15-12-22-16-11-7-6-10-14(16)17(15)13-8-4-3-5-9-13/h3-12H,2H2,1H3
InChIKeyZFPMWHKCWIGAMT-UHFFFAOYSA-N
XLogP4.56
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.33
LogP ≤ 54.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate?
The IUPAC name of ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate (CID 164676593) is ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate.
What is the SMILES notation for ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate?
The canonical SMILES for ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate is CCOC(=O)C(F)(F)c1cnc2ccccc2c1-c1ccccc1.
What is the InChIKey of ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate?
The InChIKey is ZFPMWHKCWIGAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2NO2/c1-2-24-18(23)19(20,21)15-12-22-16-11-7-6-10-14(16)17(15)13-8-4-3-5-9-13/h3-12H,2H2,1H3.
What are the key properties of ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate?
ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate has a molecular weight of 327.33 g/mol, XLogP of 4.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-difluoro-2-(4-phenylquinolin-3-yl)acetate is sourced from PubChem (CID 164676593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).