C23H17ClFNO — CID 164676981
[(6R,6aS,11bS)-2-chloro-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl]-(4-fluorophenyl)methanone (PubChem CID 164676981) has the molecular formula C23H17ClFNO and a molecular weight of 377.85 g/mol. Its IUPAC name is [(6R,6aS,11bS)-2-chloro-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(6R,6aS,11bS)-2-chloro-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 164676981 |
| Molecular Formula | C23H17ClFNO |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [(6R,6aS,11bS)-2-chloro-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)[C@@H]1Nc2ccc(Cl)cc2[C@@H]2c3ccccc3C[C@@H]21 |
| InChI | InChI=1S/C23H17ClFNO/c24-15-7-10-20-18(12-15)21-17-4-2-1-3-14(17)11-19(21)22(26-20)23(27)13-5-8-16(25)9-6-13/h1-10,12,19,21-22,26H,11H2/t19-,21-,22+/m0/s1 |
| InChIKey | BXJXWNAJXAOQBH-ILWGZMRPSA-N |
| XLogP | 5.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |