C13H9F5N2O2 — CID 164677041
methyl 4-amino-2-(1,1,2,2,2-pentafluoroethyl)quinoline-3-carboxylate (PubChem CID 164677041) has the molecular formula C13H9F5N2O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is methyl 4-amino-2-(1,1,2,2,2-pentafluoroethyl)quinoline-3-carboxylate.
| Compound Name | methyl 4-amino-2-(1,1,2,2,2-pentafluoroethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 164677041 |
| Molecular Formula | C13H9F5N2O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | methyl 4-amino-2-(1,1,2,2,2-pentafluoroethyl)quinoline-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)(F)C(F)(F)F)nc2ccccc2c1N |
| InChI | InChI=1S/C13H9F5N2O2/c1-22-11(21)8-9(19)6-4-2-3-5-7(6)20-10(8)12(14,15)13(16,17)18/h2-5H,1H3,(H2,19,20) |
| InChIKey | FBGYGMKOMYBQEW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|