C11H13F3O2 — CID 164677070
2,2,2-trifluoroethyl (2E)-2-[(1S,5S)-6-bicyclo[3.2.0]heptanylidene]acetate (PubChem CID 164677070) has the molecular formula C11H13F3O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2E)-2-[(1S,5S)-6-bicyclo[3.2.0]heptanylidene]acetate.
| Compound Name | 2,2,2-trifluoroethyl (2E)-2-[(1S,5S)-6-bicyclo[3.2.0]heptanylidene]acetate |
|---|---|
| PubChem CID | 164677070 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2,2,2-trifluoroethyl (2E)-2-[(1S,5S)-6-bicyclo[3.2.0]heptanylidene]acetate |
| SMILES | O=C(/C=C1\C[C@@H]2CCC[C@H]12)OCC(F)(F)F |
| InChI | InChI=1S/C11H13F3O2/c12-11(13,14)6-16-10(15)5-8-4-7-2-1-3-9(7)8/h5,7,9H,1-4,6H2/b8-5+/t7-,9-/m0/s1 |
| InChIKey | DPNVOTRYQGZORN-IFPZVHCUSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|