C34H32N4O4Zn — CID 164677234
zinc dimethyl 4,5,9,10,15,15-hexamethyl-26,28-diaza-25,27-diazanidahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,16(26),17,19,21,23-dodecaene-21,22-dicarboxylate (PubChem CID 164677234) has the molecular formula C34H32N4O4Zn and a molecular weight of 626.04 g/mol. Its IUPAC name is zinc dimethyl 4,5,9,10,15,15-hexamethyl-26,28-diaza-25,27-diazanidahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,16(26),17,19,21,23-dodecaene-21,22-dicarboxylate.
| Compound Name | zinc dimethyl 4,5,9,10,15,15-hexamethyl-26,28-diaza-25,27-diazanidahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,16(26),17,19,21,23-dodecaene-21,22-dicarboxylate |
|---|---|
| PubChem CID | 164677234 |
| Molecular Formula | C34H32N4O4Zn |
| Molecular Weight | 626.04 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | zinc dimethyl 4,5,9,10,15,15-hexamethyl-26,28-diaza-25,27-diazanidahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,16(26),17,19,21,23-dodecaene-21,22-dicarboxylate |
| SMILES | COC(=O)c1cc2c3cc4nc(cc5[n-]c(cc6nc(cc([n-]3)c2cc1C(=O)OC)C(C)(C)C6)c(C)c5C)C(C)=C4C.[Zn+2] |
| InChI | InChI=1S/C34H34N4O4.Zn/c1-16-17(2)26-12-27-18(3)19(4)28(37-27)13-29-21-10-23(32(39)41-7)24(33(40)42-8)11-22(21)30(38-29)14-31-34(5,6)15-20(35-31)9-25(16)36-26;/h9-14H,15H2,1-8H3,(H2,35,36,37,38,39,40);/q;+2/p-2 |
| InChIKey | ZLWXWWLPSPWNDQ-UHFFFAOYSA-L |
| XLogP | 6.38 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.04 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|