About (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate
(1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate (PubChem CID 164677333) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate.
Molecular Properties
| Compound Name | (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate |
| PubChem CID | 164677333 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate |
| SMILES | CC(OC(=O)N1CCCCCC1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-13(15(18)14-9-5-4-6-10-14)20-16(19)17-11-7-2-3-8-12-17/h4-6,9-10,13H,2-3,7-8,11-12H2,1H3 |
| InChIKey | NXQYQCAERDCKCQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate?
The IUPAC name of (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate (CID 164677333) is (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate.
What is the SMILES notation for (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate?
The canonical SMILES for (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate is CC(OC(=O)N1CCCCCC1)C(=O)c1ccccc1.
What is the InChIKey of (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate?
The InChIKey is NXQYQCAERDCKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3/c1-13(15(18)14-9-5-4-6-10-14)20-16(19)17-11-7-2-3-8-12-17/h4-6,9-10,13H,2-3,7-8,11-12H2,1H3.
What are the key properties of (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate?
(1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate has a molecular weight of 275.35 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-1-phenylpropan-2-yl) azepane-1-carboxylate is sourced from PubChem (CID 164677333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).