C37H44N4O2 — CID 164677531
[(5Z,9Z,14Z)-2,2,5,7,8,12,12,17,18-nonamethyl-15-phenyl-3,13,22,24-tetrahydrocorrin-1-yl]methyl acetate (PubChem CID 164677531) has the molecular formula C37H44N4O2 and a molecular weight of 576.79 g/mol. Its IUPAC name is [(5Z,9Z,14Z)-2,2,5,7,8,12,12,17,18-nonamethyl-15-phenyl-3,13,22,24-tetrahydrocorrin-1-yl]methyl acetate.
| Compound Name | [(5Z,9Z,14Z)-2,2,5,7,8,12,12,17,18-nonamethyl-15-phenyl-3,13,22,24-tetrahydrocorrin-1-yl]methyl acetate |
|---|---|
| PubChem CID | 164677531 |
| Molecular Formula | C37H44N4O2 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | [(5Z,9Z,14Z)-2,2,5,7,8,12,12,17,18-nonamethyl-15-phenyl-3,13,22,24-tetrahydrocorrin-1-yl]methyl acetate |
| SMILES | CC(=O)OCC12N=C(CC1(C)C)/C(C)=c1\[nH]/c(c(C)c1C)=C\C1=N/C(=C(/c3ccccc3)c3[nH]c2c(C)c3C)CC1(C)C |
| InChI | InChI=1S/C37H44N4O2/c1-20-21(2)32-24(5)28-18-36(9,10)37(41-28,19-43-25(6)42)34-23(4)22(3)33(40-34)31(26-14-12-11-13-15-26)29-17-35(7,8)30(38-29)16-27(20)39-32/h11-16,39-40H,17-19H2,1-10H3/b27-16-,31-29-,32-24- |
| InChIKey | VCKOHWZBQJBPHH-RCMKEQBZSA-N |
| XLogP | 6.50 |
| TPSA | 82.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |