C24H32O8 — CID 164677634
[(1R,2S,5S,7S,8S,11R)-5,7-diacetyloxy-13-hydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl] (Z)-2-methylbut-2-enoate (PubChem CID 164677634) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [(1R,2S,5S,7S,8S,11R)-5,7-diacetyloxy-13-hydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,5S,7S,8S,11R)-5,7-diacetyloxy-13-hydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 164677634 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(1R,2S,5S,7S,8S,11R)-5,7-diacetyloxy-13-hydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C=C2[C@H](OC(C)=O)O[C@@H](OC(C)=O)[C@H]3CC[C@@H]4C(C)(C)[C@@H]1C(O)C234 |
| InChI | InChI=1S/C24H32O8/c1-7-11(2)20(28)31-16-10-15-22(30-13(4)26)32-21(29-12(3)25)14-8-9-17-23(5,6)18(16)19(27)24(14,15)17/h7,10,14,16-19,21-22,27H,8-9H2,1-6H3/b11-7-/t14-,16+,17-,18+,19?,21-,22-,24?/m1/s1 |
| InChIKey | LIYHKSSJHASCFF-FAYQRPQLSA-N |
| XLogP | 2.64 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|