C25H26N2O6 — CID 164677685
1-(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)oxycarbonylcyclobutane-1-carboxylic acid (PubChem CID 164677685) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is 1-(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)oxycarbonylcyclobutane-1-carboxylic acid.
| Compound Name | 1-(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)oxycarbonylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 164677685 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)oxycarbonylcyclobutane-1-carboxylic acid |
| SMILES | CCCCC1(OC(=O)C2(C(=O)O)CCC2)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H26N2O6/c1-2-3-17-25(33-23(32)24(22(30)31)15-10-16-24)20(28)26(18-11-6-4-7-12-18)27(21(25)29)19-13-8-5-9-14-19/h4-9,11-14H,2-3,10,15-17H2,1H3,(H,30,31) |
| InChIKey | HZLJXGWEDKNSMV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|