C35H43BrF5N2O3P — CID 164677698
tert-butyl N-[1-[[(2S)-1-[bromo-[(2,3,4,5,6-pentafluorophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-methylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 164677698) has the molecular formula C35H43BrF5N2O3P and a molecular weight of 745.61 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2S)-1-[bromo-[(2,3,4,5,6-pentafluorophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-methylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2S)-1-[bromo-[(2,3,4,5,6-pentafluorophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-methylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 164677698 |
| Molecular Formula | C35H43BrF5N2O3P |
| Molecular Weight | 745.61 g/mol |
| Exact Mass | 744.21 |
| IUPAC Name | tert-butyl N-[1-[[(2S)-1-[bromo-[(2,3,4,5,6-pentafluorophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-methylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](CP(Br)(Cc1c(F)c(F)c(F)c(F)c1F)(c1ccccc1)c1ccccc1)NC(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C35H43BrF5N2O3P/c1-21(2)25(42-32(44)31(34(3,4)5)43-33(45)46-35(6,7)8)20-47(36,22-15-11-9-12-16-22,23-17-13-10-14-18-23)19-24-26(37)28(39)30(41)29(40)27(24)38/h9-18,21,25,31H,19-20H2,1-8H3,(H,42,44)(H,43,45)/t25-,31?/m1/s1 |
| InChIKey | PLYMGVGETYDYNN-KZQYXEPFSA-N |
| XLogP | 8.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.61 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|