C25H20FNO2 — CID 164677842
ethyl (E)-3-[2-[2-(4-fluorophenyl)ethynyl]anilino]-3-phenylprop-2-enoate (PubChem CID 164677842) has the molecular formula C25H20FNO2 and a molecular weight of 385.44 g/mol. Its IUPAC name is ethyl (E)-3-[2-[2-(4-fluorophenyl)ethynyl]anilino]-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[2-(4-fluorophenyl)ethynyl]anilino]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 164677842 |
| Molecular Formula | C25H20FNO2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | ethyl (E)-3-[2-[2-(4-fluorophenyl)ethynyl]anilino]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C=C(/Nc1ccccc1C#Cc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H20FNO2/c1-2-29-25(28)18-24(20-8-4-3-5-9-20)27-23-11-7-6-10-21(23)15-12-19-13-16-22(26)17-14-19/h3-11,13-14,16-18,27H,2H2,1H3/b24-18+ |
| InChIKey | ANHSYEAOIYMTOU-HKOYGPOVSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|