About N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine
N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine (PubChem CID 164678045) has the molecular formula C16H11BrF3N
and a molecular weight of 354.17 g/mol. Its IUPAC name is N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine.
Molecular Properties
| Compound Name | N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine |
| PubChem CID | 164678045 |
| Molecular Formula | C16H11BrF3N |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine |
| SMILES | C=C(c1ccc(Br)cc1/N=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H11BrF3N/c1-11(16(18,19)20)14-8-7-13(17)9-15(14)21-10-12-5-3-2-4-6-12/h2-10H,1H2/b21-10+ |
| InChIKey | YZCNECYTQVHGCC-UFFVCSGVSA-N |
| XLogP | 5.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine?
The IUPAC name of N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine (CID 164678045) is N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine.
What is the SMILES notation for N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine?
The canonical SMILES for N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine is C=C(c1ccc(Br)cc1/N=C/c1ccccc1)C(F)(F)F.
What is the InChIKey of N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine?
The InChIKey is YZCNECYTQVHGCC-UFFVCSGVSA-N. The full InChI is InChI=1S/C16H11BrF3N/c1-11(16(18,19)20)14-8-7-13(17)9-15(14)21-10-12-5-3-2-4-6-12/h2-10H,1H2/b21-10+.
What are the key properties of N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine?
N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine has a molecular weight of 354.17 g/mol, XLogP of 5.78, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-bromo-2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]-1-phenylmethanimine is sourced from PubChem (CID 164678045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).