C22H24N2O — CID 164678060
(1S,2R,6S)-2,6,15-trimethyl-13,15-diazapentacyclo[11.8.0.01,6.07,12.016,21]henicosa-7,9,11,16,18,20-hexaen-14-one (PubChem CID 164678060) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (1S,2R,6S)-2,6,15-trimethyl-13,15-diazapentacyclo[11.8.0.01,6.07,12.016,21]henicosa-7,9,11,16,18,20-hexaen-14-one.
| Compound Name | (1S,2R,6S)-2,6,15-trimethyl-13,15-diazapentacyclo[11.8.0.01,6.07,12.016,21]henicosa-7,9,11,16,18,20-hexaen-14-one |
|---|---|
| PubChem CID | 164678060 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (1S,2R,6S)-2,6,15-trimethyl-13,15-diazapentacyclo[11.8.0.01,6.07,12.016,21]henicosa-7,9,11,16,18,20-hexaen-14-one |
| SMILES | C[C@@H]1CCC[C@@]2(C)c3ccccc3N3C(=O)N(C)c4ccccc4[C@@]132 |
| InChI | InChI=1S/C22H24N2O/c1-15-9-8-14-21(2)16-10-4-7-13-19(16)24-20(25)23(3)18-12-6-5-11-17(18)22(15,21)24/h4-7,10-13,15H,8-9,14H2,1-3H3/t15-,21+,22-/m1/s1 |
| InChIKey | PUTUJCHNCISNNF-KBJGYGKASA-N |
| XLogP | 5.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |