C27H29BF12NP — CID 164678163
2,2-bis[3,5-bis(trifluoromethyl)phenyl]-4,4-ditert-butyl-5-methyl-1-aza-4-phosphonia-2-boranuidacyclopent-5-ene (PubChem CID 164678163) has the molecular formula C27H29BF12NP and a molecular weight of 637.30 g/mol. Its IUPAC name is 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-4,4-ditert-butyl-5-methyl-1-aza-4-phosphonia-2-boranuidacyclopent-5-ene.
| Compound Name | 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-4,4-ditert-butyl-5-methyl-1-aza-4-phosphonia-2-boranuidacyclopent-5-ene |
|---|---|
| PubChem CID | 164678163 |
| Molecular Formula | C27H29BF12NP |
| Molecular Weight | 637.30 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-4,4-ditert-butyl-5-methyl-1-aza-4-phosphonia-2-boranuidacyclopent-5-ene |
| SMILES | CC1=N[B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C[P+]1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H29BF12NP/c1-15-41-28(14-42(15,22(2,3)4)23(5,6)7,20-10-16(24(29,30)31)8-17(11-20)25(32,33)34)21-12-18(26(35,36)37)9-19(13-21)27(38,39)40/h8-13H,14H2,1-7H3 |
| InChIKey | MJEFKAQVECAKFF-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.30 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|