C29H27BF4O — CID 164678347
9-tert-butyl-7-(2,6-dimethylphenyl)benzo[c]xanthen-12-ium tetrafluoroborate (PubChem CID 164678347) has the molecular formula C29H27BF4O and a molecular weight of 478.34 g/mol. Its IUPAC name is 9-tert-butyl-7-(2,6-dimethylphenyl)benzo[c]xanthen-12-ium tetrafluoroborate.
| Compound Name | 9-tert-butyl-7-(2,6-dimethylphenyl)benzo[c]xanthen-12-ium tetrafluoroborate |
|---|---|
| PubChem CID | 164678347 |
| Molecular Formula | C29H27BF4O |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 9-tert-butyl-7-(2,6-dimethylphenyl)benzo[c]xanthen-12-ium tetrafluoroborate |
| SMILES | Cc1cccc(C)c1-c1c2cc(C(C)(C)C)ccc2[o+]c2c1ccc1ccccc12.F[B-](F)(F)F |
| InChI | InChI=1S/C29H27O.BF4/c1-18-9-8-10-19(2)26(18)27-23-15-13-20-11-6-7-12-22(20)28(23)30-25-16-14-21(17-24(25)27)29(3,4)5;2-1(3,4)5/h6-17H,1-5H3;/q+1;-1 |
| InChIKey | YSABWXPJBFLTMN-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|