C27H20F12NO2P — CID 164678434
(1R)-1-phenyl-N-[[3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole]-1-yl]methyl]ethanamine (PubChem CID 164678434) has the molecular formula C27H20F12NO2P and a molecular weight of 649.41 g/mol. Its IUPAC name is (1R)-1-phenyl-N-[[3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole]-1-yl]methyl]ethanamine.
| Compound Name | (1R)-1-phenyl-N-[[3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole]-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 164678434 |
| Molecular Formula | C27H20F12NO2P |
| Molecular Weight | 649.41 g/mol |
| Exact Mass | 649.10 |
| IUPAC Name | (1R)-1-phenyl-N-[[3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole]-1-yl]methyl]ethanamine |
| SMILES | C[C@@H](NCP12(OC(C(F)(F)F)(C(F)(F)F)c3ccccc31)OC(C(F)(F)F)(C(F)(F)F)c1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C27H20F12NO2P/c1-16(17-9-3-2-4-10-17)40-15-43(20-13-7-5-11-18(20)22(41-43,24(28,29)30)25(31,32)33)21-14-8-6-12-19(21)23(42-43,26(34,35)36)27(37,38)39/h2-14,16,40H,15H2,1H3/t16-/m1/s1 |
| InChIKey | AGSQAGMQQMRAMQ-MRXNPFEDSA-N |
| XLogP | 8.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.41 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|