C11H8Cl3NO — CID 164678493
2-(trichloromethyl)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole (PubChem CID 164678493) has the molecular formula C11H8Cl3NO and a molecular weight of 276.55 g/mol. Its IUPAC name is 2-(trichloromethyl)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole.
| Compound Name | 2-(trichloromethyl)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 164678493 |
| Molecular Formula | C11H8Cl3NO |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | 2-(trichloromethyl)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole |
| SMILES | ClC(Cl)(Cl)C1=NC2c3ccccc3CC2O1 |
| InChI | InChI=1S/C11H8Cl3NO/c12-11(13,14)10-15-9-7-4-2-1-3-6(7)5-8(9)16-10/h1-4,8-9H,5H2 |
| InChIKey | YRGXRSMZWTYYCP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|