C22H22F13NO3 — CID 164678656
[(3E)-2,2-dimethyl-3-(3-phenylpropoxyimino)butyl] 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate (PubChem CID 164678656) has the molecular formula C22H22F13NO3 and a molecular weight of 595.40 g/mol. Its IUPAC name is [(3E)-2,2-dimethyl-3-(3-phenylpropoxyimino)butyl] 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate.
| Compound Name | [(3E)-2,2-dimethyl-3-(3-phenylpropoxyimino)butyl] 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate |
|---|---|
| PubChem CID | 164678656 |
| Molecular Formula | C22H22F13NO3 |
| Molecular Weight | 595.40 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | [(3E)-2,2-dimethyl-3-(3-phenylpropoxyimino)butyl] 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate |
| SMILES | C/C(=N\OCCCc1ccccc1)C(C)(C)COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H22F13NO3/c1-13(36-39-11-7-10-14-8-5-4-6-9-14)16(2,3)12-38-15(37)17(23,24)18(25,26)19(27,28)20(29,30)21(31,32)22(33,34)35/h4-6,8-9H,7,10-12H2,1-3H3/b36-13+ |
| InChIKey | VZYSBJFGUXDWMK-FIFHTESVSA-N |
| XLogP | 7.32 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.40 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|