C19H20BrFSi — CID 164678741
benzyl-[(3Z)-4-(4-bromo-2-fluorophenyl)buta-1,3-dien-2-yl]-dimethylsilane (PubChem CID 164678741) has the molecular formula C19H20BrFSi and a molecular weight of 375.36 g/mol. Its IUPAC name is benzyl-[(3Z)-4-(4-bromo-2-fluorophenyl)buta-1,3-dien-2-yl]-dimethylsilane.
| Compound Name | benzyl-[(3Z)-4-(4-bromo-2-fluorophenyl)buta-1,3-dien-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 164678741 |
| Molecular Formula | C19H20BrFSi |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | benzyl-[(3Z)-4-(4-bromo-2-fluorophenyl)buta-1,3-dien-2-yl]-dimethylsilane |
| SMILES | C=C(/C=C\c1ccc(Br)cc1F)[Si](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H20BrFSi/c1-15(9-10-17-11-12-18(20)13-19(17)21)22(2,3)14-16-7-5-4-6-8-16/h4-13H,1,14H2,2-3H3/b10-9- |
| InChIKey | VTWYDRFJOUXDHM-KTKRTIGZSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|