C16H24O3 — CID 164678871
(1S,2R,3R,4S)-2-(4-methoxyphenyl)-1,3-dimethylcycloheptane-1,4-diol (PubChem CID 164678871) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1S,2R,3R,4S)-2-(4-methoxyphenyl)-1,3-dimethylcycloheptane-1,4-diol.
| Compound Name | (1S,2R,3R,4S)-2-(4-methoxyphenyl)-1,3-dimethylcycloheptane-1,4-diol |
|---|---|
| PubChem CID | 164678871 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1S,2R,3R,4S)-2-(4-methoxyphenyl)-1,3-dimethylcycloheptane-1,4-diol |
| SMILES | COc1ccc([C@H]2[C@@H](C)[C@@H](O)CCC[C@]2(C)O)cc1 |
| InChI | InChI=1S/C16H24O3/c1-11-14(17)5-4-10-16(2,18)15(11)12-6-8-13(19-3)9-7-12/h6-9,11,14-15,17-18H,4-5,10H2,1-3H3/t11-,14-,15+,16-/m0/s1 |
| InChIKey | AHFCVSUZYWXGRW-KSYCFECVSA-N |
| XLogP | 2.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |