C34H41BrF5N2O3P — CID 164678881
tert-butyl N-[1-[[(2S)-1-[bromo-[(2,3,4,5,6-pentafluorophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-methylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 164678881) has the molecular formula C34H41BrF5N2O3P and a molecular weight of 731.58 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2S)-1-[bromo-[(2,3,4,5,6-pentafluorophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-methylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2S)-1-[bromo-[(2,3,4,5,6-pentafluorophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-methylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 164678881 |
| Molecular Formula | C34H41BrF5N2O3P |
| Molecular Weight | 731.58 g/mol |
| Exact Mass | 730.20 |
| IUPAC Name | tert-butyl N-[1-[[(2S)-1-[bromo-[(2,3,4,5,6-pentafluorophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-methylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N[C@H](CP(Br)(Cc1c(F)c(F)c(F)c(F)c1F)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C34H41BrF5N2O3P/c1-20(2)25(41-32(43)31(21(3)4)42-33(44)45-34(5,6)7)19-46(35,22-14-10-8-11-15-22,23-16-12-9-13-17-23)18-24-26(36)28(38)30(40)29(39)27(24)37/h8-17,20-21,25,31H,18-19H2,1-7H3,(H,41,43)(H,42,44)/t25-,31?/m1/s1 |
| InChIKey | GXXSTPBWFDWPKY-KZQYXEPFSA-N |
| XLogP | 8.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.58 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|