C18H17N3O2 — CID 164678994
N-(4-ethynyl-2-morpholin-4-ylphenyl)pyridine-2-carboxamide (PubChem CID 164678994) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(4-ethynyl-2-morpholin-4-ylphenyl)pyridine-2-carboxamide.
| Compound Name | N-(4-ethynyl-2-morpholin-4-ylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 164678994 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-(4-ethynyl-2-morpholin-4-ylphenyl)pyridine-2-carboxamide |
| SMILES | C#Cc1ccc(NC(=O)c2ccccn2)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C18H17N3O2/c1-2-14-6-7-15(17(13-14)21-9-11-23-12-10-21)20-18(22)16-5-3-4-8-19-16/h1,3-8,13H,9-12H2,(H,20,22) |
| InChIKey | SFJQLIIIJDMGTD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|