C18H22F3NO4S — CID 164679064
[(1R,9S,10S,13S)-13-hydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate (PubChem CID 164679064) has the molecular formula C18H22F3NO4S and a molecular weight of 405.44 g/mol. Its IUPAC name is [(1R,9S,10S,13S)-13-hydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1R,9S,10S,13S)-13-hydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164679064 |
| Molecular Formula | C18H22F3NO4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [(1R,9S,10S,13S)-13-hydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
| SMILES | CN1CC[C@@]23C[C@@H](O)CC[C@@H]2[C@@H]1Cc1ccc(OS(=O)(=O)C(F)(F)F)cc13 |
| InChI | InChI=1S/C18H22F3NO4S/c1-22-7-6-17-10-12(23)3-5-14(17)16(22)8-11-2-4-13(9-15(11)17)26-27(24,25)18(19,20)21/h2,4,9,12,14,16,23H,3,5-8,10H2,1H3/t12-,14+,16-,17+/m0/s1 |
| InChIKey | RUCWFBDLLOOBPV-JSQNDZKTSA-N |
| XLogP | 2.57 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|