About methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate
methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate (PubChem CID 164679245) has the molecular formula C27H24BrO2P
and a molecular weight of 491.37 g/mol. Its IUPAC name is methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate.
Molecular Properties
| Compound Name | methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate |
| PubChem CID | 164679245 |
| Molecular Formula | C27H24BrO2P |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate |
| SMILES | COC(=O)c1ccccc1P(Br)(Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24BrO2P/c1-30-27(29)25-19-11-12-20-26(25)31(28,23-15-7-3-8-16-23,24-17-9-4-10-18-24)21-22-13-5-2-6-14-22/h2-20H,21H2,1H3 |
| InChIKey | JPDXAWQCJWECQG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate?
The IUPAC name of methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate (CID 164679245) is methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate.
What is the SMILES notation for methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate?
The canonical SMILES for methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate is COC(=O)c1ccccc1P(Br)(Cc1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate?
The InChIKey is JPDXAWQCJWECQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24BrO2P/c1-30-27(29)25-19-11-12-20-26(25)31(28,23-15-7-3-8-16-23,24-17-9-4-10-18-24)21-22-13-5-2-6-14-22/h2-20H,21H2,1H3.
What are the key properties of methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate?
methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate has a molecular weight of 491.37 g/mol, XLogP of 5.81, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(benzyl-bromo-diphenyl-λ5-phosphanyl)benzoate is sourced from PubChem (CID 164679245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).