C32H35NO12 — CID 164679272
[(3S,4S,6R)-3,4,5-triacetyloxy-6-[[6-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 164679272) has the molecular formula C32H35NO12 and a molecular weight of 625.63 g/mol. Its IUPAC name is [(3S,4S,6R)-3,4,5-triacetyloxy-6-[[6-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6R)-3,4,5-triacetyloxy-6-[[6-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 164679272 |
| Molecular Formula | C32H35NO12 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | [(3S,4S,6R)-3,4,5-triacetyloxy-6-[[6-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(-c2cc(CO[C@@H]3OC(COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C3OC(C)=O)c3cc(OC)ccc3n2)cc1 |
| InChI | InChI=1S/C32H35NO12/c1-17(34)40-16-28-29(42-18(2)35)30(43-19(3)36)31(44-20(4)37)32(45-28)41-15-22-13-27(21-7-9-23(38-5)10-8-21)33-26-12-11-24(39-6)14-25(22)26/h7-14,28-32H,15-16H2,1-6H3/t28?,29-,30-,31?,32+/m0/s1 |
| InChIKey | FHOOWCQUHKDIDW-ZYZOFLKDSA-N |
| XLogP | 3.52 |
| TPSA | 155.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|