About (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one
(4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one (PubChem CID 164679419) has the molecular formula C17H16FNO4S
and a molecular weight of 349.38 g/mol. Its IUPAC name is (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
| PubChem CID | 164679419 |
| Molecular Formula | C17H16FNO4S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)O[C@H](C)[C@H]2c2ccccc2F)cc1 |
| InChI | InChI=1S/C17H16FNO4S/c1-11-7-9-13(10-8-11)24(21,22)19-16(12(2)23-17(19)20)14-5-3-4-6-15(14)18/h3-10,12,16H,1-2H3/t12-,16+/m1/s1 |
| InChIKey | JRUIDCILUWIHIN-WBMJQRKESA-N |
| XLogP | 3.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one?
The IUPAC name of (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one (CID 164679419) is (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is Cc1ccc(S(=O)(=O)N2C(=O)O[C@H](C)[C@H]2c2ccccc2F)cc1.
What is the InChIKey of (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one?
The InChIKey is JRUIDCILUWIHIN-WBMJQRKESA-N. The full InChI is InChI=1S/C17H16FNO4S/c1-11-7-9-13(10-8-11)24(21,22)19-16(12(2)23-17(19)20)14-5-3-4-6-15(14)18/h3-10,12,16H,1-2H3/t12-,16+/m1/s1.
What are the key properties of (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one?
(4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one has a molecular weight of 349.38 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4-(2-fluorophenyl)-5-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 164679419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).