C17H28O4 — CID 164679471
diethyl (2E,4E)-4-tert-butyl-5-methylocta-2,4-dienedioate (PubChem CID 164679471) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is diethyl (2E,4E)-4-tert-butyl-5-methylocta-2,4-dienedioate.
| Compound Name | diethyl (2E,4E)-4-tert-butyl-5-methylocta-2,4-dienedioate |
|---|---|
| PubChem CID | 164679471 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | diethyl (2E,4E)-4-tert-butyl-5-methylocta-2,4-dienedioate |
| SMILES | CCOC(=O)/C=C/C(=C(/C)CCC(=O)OCC)C(C)(C)C |
| InChI | InChI=1S/C17H28O4/c1-7-20-15(18)11-9-13(3)14(17(4,5)6)10-12-16(19)21-8-2/h10,12H,7-9,11H2,1-6H3/b12-10+,14-13+ |
| InChIKey | MADHTQLGGSQEJM-HBKPYOMSSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|