C26H33Br2NO — CID 164679533
1-[2,2-bis(4-bromophenyl)pent-4-enoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 164679533) has the molecular formula C26H33Br2NO and a molecular weight of 535.36 g/mol. Its IUPAC name is 1-[2,2-bis(4-bromophenyl)pent-4-enoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-[2,2-bis(4-bromophenyl)pent-4-enoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 164679533 |
| Molecular Formula | C26H33Br2NO |
| Molecular Weight | 535.36 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 1-[2,2-bis(4-bromophenyl)pent-4-enoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CCC(CON1C(C)(C)CCCC1(C)C)(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H33Br2NO/c1-6-16-26(20-8-12-22(27)13-9-20,21-10-14-23(28)15-11-21)19-30-29-24(2,3)17-7-18-25(29,4)5/h6,8-15H,1,7,16-19H2,2-5H3 |
| InChIKey | YWLUWXPZVFFOOH-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.36 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|