C24H31F3NO4+ — CID 164679621
8-O-methyl 1-O-(2,2,2-trifluoroethyl) (4R)-4-[(1S)-1-phenylprop-2-enyl]-3-pyrrolidin-1-ium-1-ylideneoctanedioate (PubChem CID 164679621) has the molecular formula C24H31F3NO4+ and a molecular weight of 454.51 g/mol. Its IUPAC name is 8-O-methyl 1-O-(2,2,2-trifluoroethyl) (4R)-4-[(1S)-1-phenylprop-2-enyl]-3-pyrrolidin-1-ium-1-ylideneoctanedioate.
| Compound Name | 8-O-methyl 1-O-(2,2,2-trifluoroethyl) (4R)-4-[(1S)-1-phenylprop-2-enyl]-3-pyrrolidin-1-ium-1-ylideneoctanedioate |
|---|---|
| PubChem CID | 164679621 |
| Molecular Formula | C24H31F3NO4+ |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 8-O-methyl 1-O-(2,2,2-trifluoroethyl) (4R)-4-[(1S)-1-phenylprop-2-enyl]-3-pyrrolidin-1-ium-1-ylideneoctanedioate |
| SMILES | C=C[C@H](c1ccccc1)[C@@H](CCCC(=O)OC)C(CC(=O)OCC(F)(F)F)=[N+]1CCCC1 |
| InChI | InChI=1S/C24H31F3NO4/c1-3-19(18-10-5-4-6-11-18)20(12-9-13-22(29)31-2)21(28-14-7-8-15-28)16-23(30)32-17-24(25,26)27/h3-6,10-11,19-20H,1,7-9,12-17H2,2H3/q+1/t19-,20-/m1/s1 |
| InChIKey | IYCDFIRPCSEVCC-WOJBJXKFSA-N |
| XLogP | 4.66 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|