C28H32N2O4 — CID 164679626
propan-2-yl (5R,9S)-1,3-dibenzyl-2,4-dioxo-9-propyl-1,3-diazaspiro[4.4]non-7-ene-7-carboxylate (PubChem CID 164679626) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is propan-2-yl (5R,9S)-1,3-dibenzyl-2,4-dioxo-9-propyl-1,3-diazaspiro[4.4]non-7-ene-7-carboxylate.
| Compound Name | propan-2-yl (5R,9S)-1,3-dibenzyl-2,4-dioxo-9-propyl-1,3-diazaspiro[4.4]non-7-ene-7-carboxylate |
|---|---|
| PubChem CID | 164679626 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | propan-2-yl (5R,9S)-1,3-dibenzyl-2,4-dioxo-9-propyl-1,3-diazaspiro[4.4]non-7-ene-7-carboxylate |
| SMILES | CCC[C@H]1C=C(C(=O)OC(C)C)C[C@]12C(=O)N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C28H32N2O4/c1-4-11-24-16-23(25(31)34-20(2)3)17-28(24)26(32)29(18-21-12-7-5-8-13-21)27(33)30(28)19-22-14-9-6-10-15-22/h5-10,12-16,20,24H,4,11,17-19H2,1-3H3/t24-,28+/m0/s1 |
| InChIKey | VIWDGZSXDGAWDZ-RBJSKKJNSA-N |
| XLogP | 5.09 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|