C17H17ClO2S — CID 164680036
ethyl 2-(4-chlorophenyl)sulfanyl-3-phenylpropanoate (PubChem CID 164680036) has the molecular formula C17H17ClO2S and a molecular weight of 320.84 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)sulfanyl-3-phenylpropanoate.
| Compound Name | ethyl 2-(4-chlorophenyl)sulfanyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 164680036 |
| Molecular Formula | C17H17ClO2S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)sulfanyl-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClO2S/c1-2-20-17(19)16(12-13-6-4-3-5-7-13)21-15-10-8-14(18)9-11-15/h3-11,16H,2,12H2,1H3 |
| InChIKey | QNBAPSCQYWFBHE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |