C47H53FO9Si — CID 164680045
methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[6-(fluoromethoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropanoate (PubChem CID 164680045) has the molecular formula C47H53FO9Si and a molecular weight of 809.02 g/mol. Its IUPAC name is methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[6-(fluoromethoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropanoate.
| Compound Name | methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[6-(fluoromethoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 164680045 |
| Molecular Formula | C47H53FO9Si |
| Molecular Weight | 809.02 g/mol |
| Exact Mass | 808.34 |
| IUPAC Name | methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[6-(fluoromethoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropanoate |
| SMILES | COC(=O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC1OC(OCF)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C47H53FO9Si/c1-47(2,3)58(38-26-16-8-17-27-38,39-28-18-9-19-29-39)55-33-40(44(49)50-4)56-46-43(53-32-37-24-14-7-15-25-37)41(51-30-35-20-10-5-11-21-35)42(45(57-46)54-34-48)52-31-36-22-12-6-13-23-36/h5-29,40-43,45-46H,30-34H2,1-4H3/t40-,41?,42?,43?,45?,46?/m1/s1 |
| InChIKey | SFNBDUCTGWFGBZ-WKLYLQNRSA-N |
| XLogP | 7.50 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.02 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|