C30H34BFN2O5 — CID 164680092
2-[(2S)-5-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]pyridine (PubChem CID 164680092) has the molecular formula C30H34BFN2O5 and a molecular weight of 532.42 g/mol. Its IUPAC name is 2-[(2S)-5-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]pyridine.
| Compound Name | 2-[(2S)-5-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 164680092 |
| Molecular Formula | C30H34BFN2O5 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 2-[(2S)-5-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]pyridine |
| SMILES | CC1(C)OB([C@H]2CC(c3ccc(F)cc3)C(COc3ccc4c(c3)OCO4)CN2c2ccccn2)OC1(C)C |
| InChI | InChI=1S/C30H34BFN2O5/c1-29(2)30(3,4)39-31(38-29)27-16-24(20-8-10-22(32)11-9-20)21(17-34(27)28-7-5-6-14-33-28)18-35-23-12-13-25-26(15-23)37-19-36-25/h5-15,21,24,27H,16-19H2,1-4H3/t21?,24?,27-/m1/s1 |
| InChIKey | RXDPTWGCMDSUMT-ZNHVGUMHSA-N |
| XLogP | 5.64 |
| TPSA | 62.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|