C16H8Br2F6N2O — CID 164680283
4,12-dibromo-1,9-bis(trifluoromethyl)-17-oxa-8,16-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 164680283) has the molecular formula C16H8Br2F6N2O and a molecular weight of 518.05 g/mol. Its IUPAC name is 4,12-dibromo-1,9-bis(trifluoromethyl)-17-oxa-8,16-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | 4,12-dibromo-1,9-bis(trifluoromethyl)-17-oxa-8,16-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 164680283 |
| Molecular Formula | C16H8Br2F6N2O |
| Molecular Weight | 518.05 g/mol |
| Exact Mass | 515.89 |
| IUPAC Name | 4,12-dibromo-1,9-bis(trifluoromethyl)-17-oxa-8,16-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | FC(F)(F)C12Nc3ccc(Br)cc3C(C(F)(F)F)(Nc3ccc(Br)cc31)O2 |
| InChI | InChI=1S/C16H8Br2F6N2O/c17-7-1-3-11-9(5-7)13(15(19,20)21)26-12-4-2-8(18)6-10(12)14(25-11,27-13)16(22,23)24/h1-6,25-26H |
| InChIKey | JPHGQJHQBGLAPL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.05 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |