About 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium
1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium (PubChem CID 164680384) has the molecular formula C17H20FO3S+
and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium.
Molecular Properties
| Compound Name | 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium |
| PubChem CID | 164680384 |
| Molecular Formula | C17H20FO3S+ |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium |
| SMILES | COc1cc(OC)c([S+](c2ccccc2)C(C)F)c(OC)c1 |
| InChI | InChI=1S/C17H20FO3S/c1-12(18)22(14-8-6-5-7-9-14)17-15(20-3)10-13(19-2)11-16(17)21-4/h5-12H,1-4H3/q+1 |
| InChIKey | PGHBRICQXZGIPO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium?
The IUPAC name of 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium (CID 164680384) is 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium.
What is the SMILES notation for 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium?
The canonical SMILES for 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium is COc1cc(OC)c([S+](c2ccccc2)C(C)F)c(OC)c1.
What is the InChIKey of 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium?
The InChIKey is PGHBRICQXZGIPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FO3S/c1-12(18)22(14-8-6-5-7-9-14)17-15(20-3)10-13(19-2)11-16(17)21-4/h5-12H,1-4H3/q+1.
What are the key properties of 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium?
1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium has a molecular weight of 323.41 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium is sourced from PubChem (CID 164680384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).