About [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate
[(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate (PubChem CID 164680473) has the molecular formula C11H14NS2+
and a molecular weight of 224.37 g/mol. Its IUPAC name is [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate |
| PubChem CID | 164680473 |
| Molecular Formula | C11H14NS2+ |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SC/C=C1\C=CC=C[CH+]1 |
| InChI | InChI=1S/C11H14NS2/c1-12(2)11(13)14-9-8-10-6-4-3-5-7-10/h3-8H,9H2,1-2H3/q+1 |
| InChIKey | QPYJUJHWEFRDJG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate?
The IUPAC name of [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate (CID 164680473) is [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate.
What is the SMILES notation for [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate?
The canonical SMILES for [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate is CN(C)C(=S)SC/C=C1\C=CC=C[CH+]1.
What is the InChIKey of [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate?
The InChIKey is QPYJUJHWEFRDJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NS2/c1-12(2)11(13)14-9-8-10-6-4-3-5-7-10/h3-8H,9H2,1-2H3/q+1.
What are the key properties of [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate?
[(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate has a molecular weight of 224.37 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-2-cyclohexa-2,4-dien-1-ylideneethyl] N,N-dimethylcarbamodithioate is sourced from PubChem (CID 164680473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).