About 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine
4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine (PubChem CID 164680509) has the molecular formula C9H11IN2O2
and a molecular weight of 306.10 g/mol. Its IUPAC name is 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine.
Molecular Properties
| Compound Name | 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine |
| PubChem CID | 164680509 |
| Molecular Formula | C9H11IN2O2 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine |
| SMILES | C=CCc1c(I)nc(OC)nc1OC |
| InChI | InChI=1S/C9H11IN2O2/c1-4-5-6-7(10)11-9(14-3)12-8(6)13-2/h4H,1,5H2,2-3H3 |
| InChIKey | PUAXDIHSCWXGKK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine?
The IUPAC name of 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine (CID 164680509) is 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine.
What is the SMILES notation for 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine?
The canonical SMILES for 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine is C=CCc1c(I)nc(OC)nc1OC.
What is the InChIKey of 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine?
The InChIKey is PUAXDIHSCWXGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11IN2O2/c1-4-5-6-7(10)11-9(14-3)12-8(6)13-2/h4H,1,5H2,2-3H3.
What are the key properties of 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine?
4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine has a molecular weight of 306.10 g/mol, XLogP of 1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-2,6-dimethoxy-5-prop-2-enylpyrimidine is sourced from PubChem (CID 164680509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).