About [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide
[2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide (PubChem CID 164680550) has the molecular formula C11H6N3O-
and a molecular weight of 196.19 g/mol. Its IUPAC name is [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide.
Molecular Properties
| Compound Name | [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide |
| PubChem CID | 164680550 |
| Molecular Formula | C11H6N3O- |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide |
| SMILES | N#CC(=C=[N-])C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H6N3O/c12-5-7(6-13)10-8-3-1-2-4-9(8)14-11(10)15/h1-4,10H,(H,14,15)/q-1 |
| InChIKey | XUFOTTAVHTUANP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide?
The IUPAC name of [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide (CID 164680550) is [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide.
What is the SMILES notation for [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide?
The canonical SMILES for [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide is N#CC(=C=[N-])C1C(=O)Nc2ccccc21.
What is the InChIKey of [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide?
The InChIKey is XUFOTTAVHTUANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N3O/c12-5-7(6-13)10-8-3-1-2-4-9(8)14-11(10)15/h1-4,10H,(H,14,15)/q-1.
What are the key properties of [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide?
[2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide has a molecular weight of 196.19 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-2-(2-oxo-1,3-dihydroindol-3-yl)ethenylidene]azanide is sourced from PubChem (CID 164680550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).