C22H23NO4 — CID 164680766
dimethyl 7-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-3,3-dicarboxylate (PubChem CID 164680766) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is dimethyl 7-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-3,3-dicarboxylate.
| Compound Name | dimethyl 7-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 164680766 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | dimethyl 7-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(-c3ccccc3)cc3c2N(CCC3)C1 |
| InChI | InChI=1S/C22H23NO4/c1-26-20(24)22(21(25)27-2)13-18-12-17(15-7-4-3-5-8-15)11-16-9-6-10-23(14-22)19(16)18/h3-5,7-8,11-12H,6,9-10,13-14H2,1-2H3 |
| InChIKey | RONCJVYJYBFEGI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|