About 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one
6-(4-methoxyanilino)-2,3-dihydrochromen-4-one (PubChem CID 164680994) has the molecular formula C16H15NO3
and a molecular weight of 269.30 g/mol. Its IUPAC name is 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one |
| PubChem CID | 164680994 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(Nc2ccc3c(c2)C(=O)CCO3)cc1 |
| InChI | InChI=1S/C16H15NO3/c1-19-13-5-2-11(3-6-13)17-12-4-7-16-14(10-12)15(18)8-9-20-16/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | LIARZKXOUAEJDY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one?
The IUPAC name of 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one (CID 164680994) is 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one?
The canonical SMILES for 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one is COc1ccc(Nc2ccc3c(c2)C(=O)CCO3)cc1.
What is the InChIKey of 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one?
The InChIKey is LIARZKXOUAEJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO3/c1-19-13-5-2-11(3-6-13)17-12-4-7-16-14(10-12)15(18)8-9-20-16/h2-7,10,17H,8-9H2,1H3.
What are the key properties of 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one?
6-(4-methoxyanilino)-2,3-dihydrochromen-4-one has a molecular weight of 269.30 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxyanilino)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 164680994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).