C14H15F3O3S — CID 164681018
methyl 3,3,3-trifluoro-2-[2-(1-phenylethenoxy)ethylsulfanyl]propanoate (PubChem CID 164681018) has the molecular formula C14H15F3O3S and a molecular weight of 320.33 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-[2-(1-phenylethenoxy)ethylsulfanyl]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-[2-(1-phenylethenoxy)ethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 164681018 |
| Molecular Formula | C14H15F3O3S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-[2-(1-phenylethenoxy)ethylsulfanyl]propanoate |
| SMILES | C=C(OCCSC(C(=O)OC)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H15F3O3S/c1-10(11-6-4-3-5-7-11)20-8-9-21-12(13(18)19-2)14(15,16)17/h3-7,12H,1,8-9H2,2H3 |
| InChIKey | BHEPJMBLJQLUIO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|