C18H28O7 — CID 164681108
methyl (2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-7-oxo-6-prop-2-enyl-4a,5,8,8a-tetrahydrobenzo[b][1,4]dioxine-6-carboxylate (PubChem CID 164681108) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl (2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-7-oxo-6-prop-2-enyl-4a,5,8,8a-tetrahydrobenzo[b][1,4]dioxine-6-carboxylate.
| Compound Name | methyl (2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-7-oxo-6-prop-2-enyl-4a,5,8,8a-tetrahydrobenzo[b][1,4]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 164681108 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | methyl (2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-7-oxo-6-prop-2-enyl-4a,5,8,8a-tetrahydrobenzo[b][1,4]dioxine-6-carboxylate |
| SMILES | C=CCC1(C(=O)OC)C(=O)C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C18H28O7/c1-8-9-18(15(20)21-5)11(2)14-12(10-13(18)19)24-16(3,22-6)17(4,23-7)25-14/h8,11-12,14H,1,9-10H2,2-7H3/t11-,12-,14-,16+,17+,18?/m1/s1 |
| InChIKey | GCXHKUWSBAEZSQ-KYXWQBLQSA-N |
| XLogP | 1.84 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|